C20H19NO3S — CID 135517074
ethyl 5-ethyl-2-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]thiophene-3-carboxylate (PubChem CID 135517074) has the molecular formula C20H19NO3S and a molecular weight of 353.44 g/mol. Its IUPAC name is ethyl 5-ethyl-2-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-ethyl-2-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 135517074 |
| Molecular Formula | C20H19NO3S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | ethyl 5-ethyl-2-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CC)sc1/N=C/c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C20H19NO3S/c1-3-14-11-16(20(23)24-4-2)19(25-14)21-12-17-15-8-6-5-7-13(15)9-10-18(17)22/h5-12,22H,3-4H2,1-2H3/b21-12+ |
| InChIKey | WCVNBBDGDTULRC-CIAFOILYSA-N |
| XLogP | 5.10 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|