About 3-(4,5-diphenylimidazol-1-yl)-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanamide
3-(4,5-diphenylimidazol-1-yl)-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanamide (PubChem CID 135517143) has the molecular formula C25H22N4O2
and a molecular weight of 410.48 g/mol. Its IUPAC name is 3-(4,5-diphenylimidazol-1-yl)-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanamide.
Molecular Properties
| Compound Name | 3-(4,5-diphenylimidazol-1-yl)-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanamide |
| PubChem CID | 135517143 |
| Molecular Formula | C25H22N4O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 3-(4,5-diphenylimidazol-1-yl)-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanamide |
| SMILES | O=C(CCn1cnc(-c2ccccc2)c1-c1ccccc1)N/N=C/c1ccccc1O |
| InChI | InChI=1S/C25H22N4O2/c30-22-14-8-7-13-21(22)17-27-28-23(31)15-16-29-18-26-24(19-9-3-1-4-10-19)25(29)20-11-5-2-6-12-20/h1-14,17-18,30H,15-16H2,(H,28,31)/b27-17+ |
| InChIKey | GMKABSSSWHQPRP-WPWMEQJKSA-N |
| XLogP | 4.46 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(4,5-diphenylimidazol-1-yl)-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,5-diphenylimidazol-1-yl)-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanamide?
The IUPAC name of 3-(4,5-diphenylimidazol-1-yl)-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanamide (CID 135517143) is 3-(4,5-diphenylimidazol-1-yl)-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanamide.
What is the SMILES notation for 3-(4,5-diphenylimidazol-1-yl)-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanamide?
The canonical SMILES for 3-(4,5-diphenylimidazol-1-yl)-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanamide is O=C(CCn1cnc(-c2ccccc2)c1-c1ccccc1)N/N=C/c1ccccc1O.
What is the InChIKey of 3-(4,5-diphenylimidazol-1-yl)-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanamide?
The InChIKey is GMKABSSSWHQPRP-WPWMEQJKSA-N. The full InChI is InChI=1S/C25H22N4O2/c30-22-14-8-7-13-21(22)17-27-28-23(31)15-16-29-18-26-24(19-9-3-1-4-10-19)25(29)20-11-5-2-6-12-20/h1-14,17-18,30H,15-16H2,(H,28,31)/b27-17+.
What are the key properties of 3-(4,5-diphenylimidazol-1-yl)-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanamide?
3-(4,5-diphenylimidazol-1-yl)-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanamide has a molecular weight of 410.48 g/mol, XLogP of 4.46, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-diphenylimidazol-1-yl)-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanamide is sourced from PubChem (CID 135517143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).