C18H20N4O2S — CID 135517196
ethyl 2,4-dimethyl-5-(2-phenylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)-1H-pyrrole-3-carboxylate (PubChem CID 135517196) has the molecular formula C18H20N4O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is ethyl 2,4-dimethyl-5-(2-phenylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 2,4-dimethyl-5-(2-phenylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 135517196 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | ethyl 2,4-dimethyl-5-(2-phenylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(C2=NN/C(=N/c3ccccc3)SC2)c1C |
| InChI | InChI=1S/C18H20N4O2S/c1-4-24-17(23)15-11(2)16(19-12(15)3)14-10-25-18(22-21-14)20-13-8-6-5-7-9-13/h5-9,19H,4,10H2,1-3H3,(H,20,22) |
| InChIKey | HKZRQNAKIFHTMK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|