About (2E)-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-5,5-dimethyl-1,3-thiazolidin-4-one
(2E)-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-5,5-dimethyl-1,3-thiazolidin-4-one (PubChem CID 135517209) has the molecular formula C10H11N3O2S
and a molecular weight of 237.28 g/mol. Its IUPAC name is (2E)-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-5,5-dimethyl-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | (2E)-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-5,5-dimethyl-1,3-thiazolidin-4-one |
| PubChem CID | 135517209 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | (2E)-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-5,5-dimethyl-1,3-thiazolidin-4-one |
| SMILES | CC1(C)S/C(=N/N=C/c2ccco2)NC1=O |
| InChI | InChI=1S/C10H11N3O2S/c1-10(2)8(14)12-9(16-10)13-11-6-7-4-3-5-15-7/h3-6H,1-2H3,(H,12,13,14)/b11-6+ |
| InChIKey | IJSBIFYRYORHMZ-IZZDOVSWSA-N |
| XLogP | 1.61 |
| TPSA | 66.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-5,5-dimethyl-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-5,5-dimethyl-1,3-thiazolidin-4-one?
The IUPAC name of (2E)-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-5,5-dimethyl-1,3-thiazolidin-4-one (CID 135517209) is (2E)-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-5,5-dimethyl-1,3-thiazolidin-4-one.
What is the SMILES notation for (2E)-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-5,5-dimethyl-1,3-thiazolidin-4-one?
The canonical SMILES for (2E)-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-5,5-dimethyl-1,3-thiazolidin-4-one is CC1(C)S/C(=N/N=C/c2ccco2)NC1=O.
What is the InChIKey of (2E)-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-5,5-dimethyl-1,3-thiazolidin-4-one?
The InChIKey is IJSBIFYRYORHMZ-IZZDOVSWSA-N. The full InChI is InChI=1S/C10H11N3O2S/c1-10(2)8(14)12-9(16-10)13-11-6-7-4-3-5-15-7/h3-6H,1-2H3,(H,12,13,14)/b11-6+.
What are the key properties of (2E)-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-5,5-dimethyl-1,3-thiazolidin-4-one?
(2E)-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-5,5-dimethyl-1,3-thiazolidin-4-one has a molecular weight of 237.28 g/mol, XLogP of 1.61, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-5,5-dimethyl-1,3-thiazolidin-4-one is sourced from PubChem (CID 135517209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).