C31H29ClN4O4 — CID 135517270
5-[5-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]-5-oxopentanoic acid (PubChem CID 135517270) has the molecular formula C31H29ClN4O4 and a molecular weight of 557.05 g/mol. Its IUPAC name is 5-[5-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]-5-oxopentanoic acid.
| Compound Name | 5-[5-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 135517270 |
| Molecular Formula | C31H29ClN4O4 |
| Molecular Weight | 557.05 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | 5-[5-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]-5-oxopentanoic acid |
| SMILES | CN(C)c1ccc(C2CC(c3c(-c4ccccc4)c4cc(Cl)ccc4[nH]c3=O)=NN2C(=O)CCCC(=O)O)cc1 |
| InChI | InChI=1S/C31H29ClN4O4/c1-35(2)22-14-11-19(12-15-22)26-18-25(34-36(26)27(37)9-6-10-28(38)39)30-29(20-7-4-3-5-8-20)23-17-21(32)13-16-24(23)33-31(30)40/h3-5,7-8,11-17,26H,6,9-10,18H2,1-2H3,(H,33,40)(H,38,39) |
| InChIKey | UFOQJQPRTHUDAK-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.05 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|