About 4-ethoxy-N'-hydroxy-6-(N-phenylanilino)-1,3,5-triazine-2-carboximidamide
4-ethoxy-N'-hydroxy-6-(N-phenylanilino)-1,3,5-triazine-2-carboximidamide (PubChem CID 135517606) has the molecular formula C18H18N6O2
and a molecular weight of 350.38 g/mol. Its IUPAC name is 4-ethoxy-N'-hydroxy-6-(N-phenylanilino)-1,3,5-triazine-2-carboximidamide.
Molecular Properties
| Compound Name | 4-ethoxy-N'-hydroxy-6-(N-phenylanilino)-1,3,5-triazine-2-carboximidamide |
| PubChem CID | 135517606 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 4-ethoxy-N'-hydroxy-6-(N-phenylanilino)-1,3,5-triazine-2-carboximidamide |
| SMILES | CCOc1nc(/C(N)=N\O)nc(N(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C18H18N6O2/c1-2-26-18-21-16(15(19)23-25)20-17(22-18)24(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,25H,2H2,1H3,(H2,19,23) |
| InChIKey | KQXPUBYYLZTTEL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxy-N'-hydroxy-6-(N-phenylanilino)-1,3,5-triazine-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-N'-hydroxy-6-(N-phenylanilino)-1,3,5-triazine-2-carboximidamide?
The IUPAC name of 4-ethoxy-N'-hydroxy-6-(N-phenylanilino)-1,3,5-triazine-2-carboximidamide (CID 135517606) is 4-ethoxy-N'-hydroxy-6-(N-phenylanilino)-1,3,5-triazine-2-carboximidamide.
What is the SMILES notation for 4-ethoxy-N'-hydroxy-6-(N-phenylanilino)-1,3,5-triazine-2-carboximidamide?
The canonical SMILES for 4-ethoxy-N'-hydroxy-6-(N-phenylanilino)-1,3,5-triazine-2-carboximidamide is CCOc1nc(/C(N)=N\O)nc(N(c2ccccc2)c2ccccc2)n1.
What is the InChIKey of 4-ethoxy-N'-hydroxy-6-(N-phenylanilino)-1,3,5-triazine-2-carboximidamide?
The InChIKey is KQXPUBYYLZTTEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N6O2/c1-2-26-18-21-16(15(19)23-25)20-17(22-18)24(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,25H,2H2,1H3,(H2,19,23).
What are the key properties of 4-ethoxy-N'-hydroxy-6-(N-phenylanilino)-1,3,5-triazine-2-carboximidamide?
4-ethoxy-N'-hydroxy-6-(N-phenylanilino)-1,3,5-triazine-2-carboximidamide has a molecular weight of 350.38 g/mol, XLogP of 2.83, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-N'-hydroxy-6-(N-phenylanilino)-1,3,5-triazine-2-carboximidamide is sourced from PubChem (CID 135517606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).