C9H15N5O — CID 135518060
(6S)-2-amino-6-propyl-5,6,7,8-tetrahydro-3H-pteridin-4-one (PubChem CID 135518060) has the molecular formula C9H15N5O and a molecular weight of 209.25 g/mol. Its IUPAC name is (6S)-2-amino-6-propyl-5,6,7,8-tetrahydro-3H-pteridin-4-one.
| Compound Name | (6S)-2-amino-6-propyl-5,6,7,8-tetrahydro-3H-pteridin-4-one |
|---|---|
| PubChem CID | 135518060 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | (6S)-2-amino-6-propyl-5,6,7,8-tetrahydro-3H-pteridin-4-one |
| SMILES | CCC[C@H]1CNc2nc(N)[nH]c(=O)c2N1 |
| InChI | InChI=1S/C9H15N5O/c1-2-3-5-4-11-7-6(12-5)8(15)14-9(10)13-7/h5,12H,2-4H2,1H3,(H4,10,11,13,14,15)/t5-/m0/s1 |
| InChIKey | NABLTMGJMSJTNW-YFKPBYRVSA-N |
| XLogP | 0.36 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |