C10H13N5O3S — CID 135518136
5-(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)pentanamide (PubChem CID 135518136) has the molecular formula C10H13N5O3S and a molecular weight of 283.31 g/mol. Its IUPAC name is 5-(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)pentanamide.
| Compound Name | 5-(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)pentanamide |
|---|---|
| PubChem CID | 135518136 |
| Molecular Formula | C10H13N5O3S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 5-(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)pentanamide |
| SMILES | NC(=O)CCCCn1c(=O)sc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C10H13N5O3S/c11-5(16)3-1-2-4-15-7-6(19-10(15)18)8(17)14-9(12)13-7/h1-4H2,(H2,11,16)(H3,12,13,14,17) |
| InChIKey | WUMIIWSAJHXIIN-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 136.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|