About 2-amino-5,6-dimethyl-3-[(2-methylphenyl)diazenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one
2-amino-5,6-dimethyl-3-[(2-methylphenyl)diazenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 135518161) has the molecular formula C15H16N6O
and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-amino-5,6-dimethyl-3-[(2-methylphenyl)diazenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one.
Molecular Properties
| Compound Name | 2-amino-5,6-dimethyl-3-[(2-methylphenyl)diazenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| PubChem CID | 135518161 |
| Molecular Formula | C15H16N6O |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-amino-5,6-dimethyl-3-[(2-methylphenyl)diazenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | Cc1ccccc1/N=N/c1c(N)[nH]n2c(=O)c(C)c(C)nc12 |
| InChI | InChI=1S/C15H16N6O/c1-8-6-4-5-7-11(8)18-19-12-13(16)20-21-14(12)17-10(3)9(2)15(21)22/h4-7,20H,16H2,1-3H3/b19-18+ |
| InChIKey | FGLMKZGNORPEIP-VHEBQXMUSA-N |
| XLogP | 2.95 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5,6-dimethyl-3-[(2-methylphenyl)diazenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5,6-dimethyl-3-[(2-methylphenyl)diazenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The IUPAC name of 2-amino-5,6-dimethyl-3-[(2-methylphenyl)diazenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one (CID 135518161) is 2-amino-5,6-dimethyl-3-[(2-methylphenyl)diazenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one.
What is the SMILES notation for 2-amino-5,6-dimethyl-3-[(2-methylphenyl)diazenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The canonical SMILES for 2-amino-5,6-dimethyl-3-[(2-methylphenyl)diazenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one is Cc1ccccc1/N=N/c1c(N)[nH]n2c(=O)c(C)c(C)nc12.
What is the InChIKey of 2-amino-5,6-dimethyl-3-[(2-methylphenyl)diazenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The InChIKey is FGLMKZGNORPEIP-VHEBQXMUSA-N. The full InChI is InChI=1S/C15H16N6O/c1-8-6-4-5-7-11(8)18-19-12-13(16)20-21-14(12)17-10(3)9(2)15(21)22/h4-7,20H,16H2,1-3H3/b19-18+.
What are the key properties of 2-amino-5,6-dimethyl-3-[(2-methylphenyl)diazenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one?
2-amino-5,6-dimethyl-3-[(2-methylphenyl)diazenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one has a molecular weight of 296.33 g/mol, XLogP of 2.95, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5,6-dimethyl-3-[(2-methylphenyl)diazenyl]-1H-pyrazolo[1,5-a]pyrimidin-7-one is sourced from PubChem (CID 135518161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).