About 2-anilino-9-[4-(3,4-dihydro-2H-quinolin-1-yl)butyl]-1H-purin-6-one
2-anilino-9-[4-(3,4-dihydro-2H-quinolin-1-yl)butyl]-1H-purin-6-one (PubChem CID 135518344) has the molecular formula C24H26N6O
and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-anilino-9-[4-(3,4-dihydro-2H-quinolin-1-yl)butyl]-1H-purin-6-one.
Molecular Properties
| Compound Name | 2-anilino-9-[4-(3,4-dihydro-2H-quinolin-1-yl)butyl]-1H-purin-6-one |
| PubChem CID | 135518344 |
| Molecular Formula | C24H26N6O |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 2-anilino-9-[4-(3,4-dihydro-2H-quinolin-1-yl)butyl]-1H-purin-6-one |
| SMILES | O=c1[nH]c(Nc2ccccc2)nc2c1ncn2CCCCN1CCCc2ccccc21 |
| InChI | InChI=1S/C24H26N6O/c31-23-21-22(27-24(28-23)26-19-11-2-1-3-12-19)30(17-25-21)15-7-6-14-29-16-8-10-18-9-4-5-13-20(18)29/h1-5,9,11-13,17H,6-8,10,14-16H2,(H2,26,27,28,31) |
| InChIKey | KNVOULAIZRSUIY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-anilino-9-[4-(3,4-dihydro-2H-quinolin-1-yl)butyl]-1H-purin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilino-9-[4-(3,4-dihydro-2H-quinolin-1-yl)butyl]-1H-purin-6-one?
The IUPAC name of 2-anilino-9-[4-(3,4-dihydro-2H-quinolin-1-yl)butyl]-1H-purin-6-one (CID 135518344) is 2-anilino-9-[4-(3,4-dihydro-2H-quinolin-1-yl)butyl]-1H-purin-6-one.
What is the SMILES notation for 2-anilino-9-[4-(3,4-dihydro-2H-quinolin-1-yl)butyl]-1H-purin-6-one?
The canonical SMILES for 2-anilino-9-[4-(3,4-dihydro-2H-quinolin-1-yl)butyl]-1H-purin-6-one is O=c1[nH]c(Nc2ccccc2)nc2c1ncn2CCCCN1CCCc2ccccc21.
What is the InChIKey of 2-anilino-9-[4-(3,4-dihydro-2H-quinolin-1-yl)butyl]-1H-purin-6-one?
The InChIKey is KNVOULAIZRSUIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N6O/c31-23-21-22(27-24(28-23)26-19-11-2-1-3-12-19)30(17-25-21)15-7-6-14-29-16-8-10-18-9-4-5-13-20(18)29/h1-5,9,11-13,17H,6-8,10,14-16H2,(H2,26,27,28,31).
What are the key properties of 2-anilino-9-[4-(3,4-dihydro-2H-quinolin-1-yl)butyl]-1H-purin-6-one?
2-anilino-9-[4-(3,4-dihydro-2H-quinolin-1-yl)butyl]-1H-purin-6-one has a molecular weight of 414.51 g/mol, XLogP of 4.10, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilino-9-[4-(3,4-dihydro-2H-quinolin-1-yl)butyl]-1H-purin-6-one is sourced from PubChem (CID 135518344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).