About [amino-(2,6-dichloroanilino)methylidene]-dimethylazanium chloride
[amino-(2,6-dichloroanilino)methylidene]-dimethylazanium chloride (PubChem CID 135518416) has the molecular formula C9H12Cl3N3
and a molecular weight of 268.57 g/mol. Its IUPAC name is [amino-(2,6-dichloroanilino)methylidene]-dimethylazanium chloride.
Molecular Properties
| Compound Name | [amino-(2,6-dichloroanilino)methylidene]-dimethylazanium chloride |
| PubChem CID | 135518416 |
| Molecular Formula | C9H12Cl3N3 |
| Molecular Weight | 268.57 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | [amino-(2,6-dichloroanilino)methylidene]-dimethylazanium chloride |
| SMILES | C[N+](C)=C(N)Nc1c(Cl)cccc1Cl.[Cl-] |
| InChI | InChI=1S/C9H11Cl2N3.ClH/c1-14(2)9(12)13-8-6(10)4-3-5-7(8)11;/h3-5H,1-2H3,(H2,12,13);1H |
| InChIKey | KOJUGTGXMMDWFF-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 41.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.57 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [amino-(2,6-dichloroanilino)methylidene]-dimethylazanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [amino-(2,6-dichloroanilino)methylidene]-dimethylazanium chloride?
The IUPAC name of [amino-(2,6-dichloroanilino)methylidene]-dimethylazanium chloride (CID 135518416) is [amino-(2,6-dichloroanilino)methylidene]-dimethylazanium chloride.
What is the SMILES notation for [amino-(2,6-dichloroanilino)methylidene]-dimethylazanium chloride?
The canonical SMILES for [amino-(2,6-dichloroanilino)methylidene]-dimethylazanium chloride is C[N+](C)=C(N)Nc1c(Cl)cccc1Cl.[Cl-].
What is the InChIKey of [amino-(2,6-dichloroanilino)methylidene]-dimethylazanium chloride?
The InChIKey is KOJUGTGXMMDWFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11Cl2N3.ClH/c1-14(2)9(12)13-8-6(10)4-3-5-7(8)11;/h3-5H,1-2H3,(H2,12,13);1H.
What are the key properties of [amino-(2,6-dichloroanilino)methylidene]-dimethylazanium chloride?
[amino-(2,6-dichloroanilino)methylidene]-dimethylazanium chloride has a molecular weight of 268.57 g/mol, XLogP of -1.00, 1 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [amino-(2,6-dichloroanilino)methylidene]-dimethylazanium chloride is sourced from PubChem (CID 135518416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).