C18H21ClN4O4S — CID 135518483
N-(4-chloro-2,5-dimethoxyphenyl)-2-[2-(cyclopentylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135518483) has the molecular formula C18H21ClN4O4S and a molecular weight of 424.91 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-2-[2-(cyclopentylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-[2-(cyclopentylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135518483 |
| Molecular Formula | C18H21ClN4O4S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-[2-(cyclopentylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | COc1cc(NC(=O)CC2SC(=NN=C3CCCC3)NC2=O)c(OC)cc1Cl |
| InChI | InChI=1S/C18H21ClN4O4S/c1-26-13-8-12(14(27-2)7-11(13)19)20-16(24)9-15-17(25)21-18(28-15)23-22-10-5-3-4-6-10/h7-8,15H,3-6,9H2,1-2H3,(H,20,24)(H,21,23,25) |
| InChIKey | YJFHOPOJJUWIPV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|