About N'-amino-4-cyano-5-oxido-1,2,5-oxadiazol-5-ium-3-carboximidamide
N'-amino-4-cyano-5-oxido-1,2,5-oxadiazol-5-ium-3-carboximidamide (PubChem CID 135519033) has the molecular formula C4H4N6O2
and a molecular weight of 168.12 g/mol. Its IUPAC name is N'-amino-4-cyano-5-oxido-1,2,5-oxadiazol-5-ium-3-carboximidamide.
Molecular Properties
| Compound Name | N'-amino-4-cyano-5-oxido-1,2,5-oxadiazol-5-ium-3-carboximidamide |
| PubChem CID | 135519033 |
| Molecular Formula | C4H4N6O2 |
| Molecular Weight | 168.12 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | N'-amino-4-cyano-5-oxido-1,2,5-oxadiazol-5-ium-3-carboximidamide |
| SMILES | N#Cc1c(/C(N)=N\N)no[n+]1[O-] |
| InChI | InChI=1S/C4H4N6O2/c5-1-2-3(4(6)8-7)9-12-10(2)11/h7H2,(H2,6,8) |
| InChIKey | FJWFNENTFTUJFR-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 141.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.12 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-amino-4-cyano-5-oxido-1,2,5-oxadiazol-5-ium-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-amino-4-cyano-5-oxido-1,2,5-oxadiazol-5-ium-3-carboximidamide?
The IUPAC name of N'-amino-4-cyano-5-oxido-1,2,5-oxadiazol-5-ium-3-carboximidamide (CID 135519033) is N'-amino-4-cyano-5-oxido-1,2,5-oxadiazol-5-ium-3-carboximidamide.
What is the SMILES notation for N'-amino-4-cyano-5-oxido-1,2,5-oxadiazol-5-ium-3-carboximidamide?
The canonical SMILES for N'-amino-4-cyano-5-oxido-1,2,5-oxadiazol-5-ium-3-carboximidamide is N#Cc1c(/C(N)=N\N)no[n+]1[O-].
What is the InChIKey of N'-amino-4-cyano-5-oxido-1,2,5-oxadiazol-5-ium-3-carboximidamide?
The InChIKey is FJWFNENTFTUJFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N6O2/c5-1-2-3(4(6)8-7)9-12-10(2)11/h7H2,(H2,6,8).
What are the key properties of N'-amino-4-cyano-5-oxido-1,2,5-oxadiazol-5-ium-3-carboximidamide?
N'-amino-4-cyano-5-oxido-1,2,5-oxadiazol-5-ium-3-carboximidamide has a molecular weight of 168.12 g/mol, XLogP of -2.24, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-amino-4-cyano-5-oxido-1,2,5-oxadiazol-5-ium-3-carboximidamide is sourced from PubChem (CID 135519033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).