C7H11N5O — CID 135519036
2-(methylamino)-5,6,7,8-tetrahydro-3H-pteridin-4-one (PubChem CID 135519036) has the molecular formula C7H11N5O and a molecular weight of 181.20 g/mol. Its IUPAC name is 2-(methylamino)-5,6,7,8-tetrahydro-3H-pteridin-4-one.
| Compound Name | 2-(methylamino)-5,6,7,8-tetrahydro-3H-pteridin-4-one |
|---|---|
| PubChem CID | 135519036 |
| Molecular Formula | C7H11N5O |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | 2-(methylamino)-5,6,7,8-tetrahydro-3H-pteridin-4-one |
| SMILES | CNc1nc2c(c(=O)[nH]1)NCCN2 |
| InChI | InChI=1S/C7H11N5O/c1-8-7-11-5-4(6(13)12-7)9-2-3-10-5/h9H,2-3H2,1H3,(H3,8,10,11,12,13) |
| InChIKey | NDUXUZLBDMASII-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |