C16H19N5O — CID 135519116
N-[(E)-4,5,6,7-tetrahydro-1H-indol-2-ylmethylideneamino]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxamide (PubChem CID 135519116) has the molecular formula C16H19N5O and a molecular weight of 297.36 g/mol. Its IUPAC name is N-[(E)-4,5,6,7-tetrahydro-1H-indol-2-ylmethylideneamino]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxamide.
| Compound Name | N-[(E)-4,5,6,7-tetrahydro-1H-indol-2-ylmethylideneamino]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135519116 |
| Molecular Formula | C16H19N5O |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | N-[(E)-4,5,6,7-tetrahydro-1H-indol-2-ylmethylideneamino]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxamide |
| SMILES | O=C(N/N=C/c1cc2c([nH]1)CCCC2)c1n[nH]c2c1CCC2 |
| InChI | InChI=1S/C16H19N5O/c22-16(15-12-5-3-7-14(12)19-20-15)21-17-9-11-8-10-4-1-2-6-13(10)18-11/h8-9,18H,1-7H2,(H,19,20)(H,21,22)/b17-9+ |
| InChIKey | UIMIZNCMPUJXGP-RQZCQDPDSA-N |
| XLogP | 1.87 |
| TPSA | 85.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|