C17H12N4O2 — CID 135519340
7-(5-benzyl-1,3,4-oxadiazol-2-yl)-1,6-naphthyridin-8-ol (PubChem CID 135519340) has the molecular formula C17H12N4O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is 7-(5-benzyl-1,3,4-oxadiazol-2-yl)-1,6-naphthyridin-8-ol.
| Compound Name | 7-(5-benzyl-1,3,4-oxadiazol-2-yl)-1,6-naphthyridin-8-ol |
|---|---|
| PubChem CID | 135519340 |
| Molecular Formula | C17H12N4O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 7-(5-benzyl-1,3,4-oxadiazol-2-yl)-1,6-naphthyridin-8-ol |
| SMILES | Oc1c(-c2nnc(Cc3ccccc3)o2)ncc2cccnc12 |
| InChI | InChI=1S/C17H12N4O2/c22-16-14-12(7-4-8-18-14)10-19-15(16)17-21-20-13(23-17)9-11-5-2-1-3-6-11/h1-8,10,22H,9H2 |
| InChIKey | XSRJUIGPNSIGAA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 84.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |