C13H16Cl4N6O2S — CID 135519426
2-[(E)-[6-(2,5-dihydroxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]guanidine;tetrahydrochloride (PubChem CID 135519426) has the molecular formula C13H16Cl4N6O2S and a molecular weight of 462.19 g/mol. Its IUPAC name is 2-[(E)-[6-(2,5-dihydroxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]guanidine;tetrahydrochloride.
| Compound Name | 2-[(E)-[6-(2,5-dihydroxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]guanidine;tetrahydrochloride |
|---|---|
| PubChem CID | 135519426 |
| Molecular Formula | C13H16Cl4N6O2S |
| Molecular Weight | 462.19 g/mol |
| Exact Mass | 459.98 |
| IUPAC Name | 2-[(E)-[6-(2,5-dihydroxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]guanidine;tetrahydrochloride |
| SMILES | Cl.Cl.Cl.Cl.NC(N)=N/N=C/c1c(-c2cc(O)ccc2O)nc2sccn12 |
| InChI | InChI=1S/C13H12N6O2S.4ClH/c14-12(15)18-16-6-9-11(17-13-19(9)3-4-22-13)8-5-7(20)1-2-10(8)21;;;;/h1-6,20-21H,(H4,14,15,18);4*1H/b16-6+;;;; |
| InChIKey | FPNZEGXEEPNABG-UDJJRGRASA-N |
| XLogP | 2.77 |
| TPSA | 134.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.19 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|