C38H48N2O4 — CID 135519780
2-[6-[4,4-dimethyl-2-oxo-6-(2-phenylethylimino)cyclohexylidene]-1,6-dihydroxyhexylidene]-5,5-dimethyl-3-(2-phenylethylimino)cyclohexan-1-one (PubChem CID 135519780) has the molecular formula C38H48N2O4 and a molecular weight of 596.81 g/mol. Its IUPAC name is 2-[6-[4,4-dimethyl-2-oxo-6-(2-phenylethylimino)cyclohexylidene]-1,6-dihydroxyhexylidene]-5,5-dimethyl-3-(2-phenylethylimino)cyclohexan-1-one.
| Compound Name | 2-[6-[4,4-dimethyl-2-oxo-6-(2-phenylethylimino)cyclohexylidene]-1,6-dihydroxyhexylidene]-5,5-dimethyl-3-(2-phenylethylimino)cyclohexan-1-one |
|---|---|
| PubChem CID | 135519780 |
| Molecular Formula | C38H48N2O4 |
| Molecular Weight | 596.81 g/mol |
| Exact Mass | 596.36 |
| IUPAC Name | 2-[6-[4,4-dimethyl-2-oxo-6-(2-phenylethylimino)cyclohexylidene]-1,6-dihydroxyhexylidene]-5,5-dimethyl-3-(2-phenylethylimino)cyclohexan-1-one |
| SMILES | CC1(C)CC(=O)C(=C(O)CCCCC(O)=C2C(=O)CC(C)(C)C/C2=N\CCc2ccccc2)/C(=N/CCc2ccccc2)C1 |
| InChI | InChI=1S/C38H48N2O4/c1-37(2)23-29(39-21-19-27-13-7-5-8-14-27)35(33(43)25-37)31(41)17-11-12-18-32(42)36-30(24-38(3,4)26-34(36)44)40-22-20-28-15-9-6-10-16-28/h5-10,13-16,41-42H,11-12,17-26H2,1-4H3/b35-31?,36-32?,39-29+,40-30+ |
| InChIKey | ZJMKUIFEDGWECE-IBYJJULZSA-N |
| XLogP | 8.32 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.81 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|