C19H22N4S — CID 135519882
N-benzyl-5-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135519882) has the molecular formula C19H22N4S and a molecular weight of 338.48 g/mol. Its IUPAC name is N-benzyl-5-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | N-benzyl-5-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135519882 |
| Molecular Formula | C19H22N4S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N-benzyl-5-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | C=CCn1c(C)cc(C2=NN/C(=N/Cc3ccccc3)SC2)c1C |
| InChI | InChI=1S/C19H22N4S/c1-4-10-23-14(2)11-17(15(23)3)18-13-24-19(22-21-18)20-12-16-8-6-5-7-9-16/h4-9,11H,1,10,12-13H2,2-3H3,(H,20,22) |
| InChIKey | LJLCBNTWMCUTPX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 41.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|