C19H19N3O3S — CID 135519940
1-(3,4-dihydro-1H-isoquinolin-2-yl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propan-1-one (PubChem CID 135519940) has the molecular formula C19H19N3O3S and a molecular weight of 369.45 g/mol. Its IUPAC name is 1-(3,4-dihydro-1H-isoquinolin-2-yl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propan-1-one.
| Compound Name | 1-(3,4-dihydro-1H-isoquinolin-2-yl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propan-1-one |
|---|---|
| PubChem CID | 135519940 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 1-(3,4-dihydro-1H-isoquinolin-2-yl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propan-1-one |
| SMILES | CC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C19H19N3O3S/c1-13(19(23)22-11-10-14-6-2-3-7-15(14)12-22)20-18-16-8-4-5-9-17(16)26(24,25)21-18/h2-9,13H,10-12H2,1H3,(H,20,21) |
| InChIKey | RPFLDHZNMCVVDP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|