About 4-bromo-2-[(E)-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]methyl]phenol
4-bromo-2-[(E)-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]methyl]phenol (PubChem CID 135519992) has the molecular formula C13H13BrN4O
and a molecular weight of 321.18 g/mol. Its IUPAC name is 4-bromo-2-[(E)-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]methyl]phenol.
Molecular Properties
| Compound Name | 4-bromo-2-[(E)-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]methyl]phenol |
| PubChem CID | 135519992 |
| Molecular Formula | C13H13BrN4O |
| Molecular Weight | 321.18 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 4-bromo-2-[(E)-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]methyl]phenol |
| SMILES | Cc1cc(C)nc(N/N=C/c2cc(Br)ccc2O)n1 |
| InChI | InChI=1S/C13H13BrN4O/c1-8-5-9(2)17-13(16-8)18-15-7-10-6-11(14)3-4-12(10)19/h3-7,19H,1-2H3,(H,16,17,18)/b15-7+ |
| InChIKey | OHGBRHOHCXGAIT-VIZOYTHASA-N |
| XLogP | 3.01 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.18 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2-[(E)-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-[(E)-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]methyl]phenol?
The IUPAC name of 4-bromo-2-[(E)-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]methyl]phenol (CID 135519992) is 4-bromo-2-[(E)-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]methyl]phenol.
What is the SMILES notation for 4-bromo-2-[(E)-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]methyl]phenol?
The canonical SMILES for 4-bromo-2-[(E)-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]methyl]phenol is Cc1cc(C)nc(N/N=C/c2cc(Br)ccc2O)n1.
What is the InChIKey of 4-bromo-2-[(E)-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]methyl]phenol?
The InChIKey is OHGBRHOHCXGAIT-VIZOYTHASA-N. The full InChI is InChI=1S/C13H13BrN4O/c1-8-5-9(2)17-13(16-8)18-15-7-10-6-11(14)3-4-12(10)19/h3-7,19H,1-2H3,(H,16,17,18)/b15-7+.
What are the key properties of 4-bromo-2-[(E)-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]methyl]phenol?
4-bromo-2-[(E)-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]methyl]phenol has a molecular weight of 321.18 g/mol, XLogP of 3.01, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-[(E)-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]methyl]phenol is sourced from PubChem (CID 135519992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).