About 4-hydroxy-1,3-dimethyl-5-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one
4-hydroxy-1,3-dimethyl-5-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 135520434) has the molecular formula C14H13N3O2
and a molecular weight of 255.28 g/mol. Its IUPAC name is 4-hydroxy-1,3-dimethyl-5-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one.
Molecular Properties
| Compound Name | 4-hydroxy-1,3-dimethyl-5-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one |
| PubChem CID | 135520434 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 4-hydroxy-1,3-dimethyl-5-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | Cc1nn(C)c2[nH]c(=O)c(-c3ccccc3)c(O)c12 |
| InChI | InChI=1S/C14H13N3O2/c1-8-10-12(18)11(9-6-4-3-5-7-9)14(19)15-13(10)17(2)16-8/h3-7H,1-2H3,(H2,15,18,19) |
| InChIKey | FNLKKUVKOQVAIR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-hydroxy-1,3-dimethyl-5-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-1,3-dimethyl-5-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one?
The IUPAC name of 4-hydroxy-1,3-dimethyl-5-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one (CID 135520434) is 4-hydroxy-1,3-dimethyl-5-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one.
What is the SMILES notation for 4-hydroxy-1,3-dimethyl-5-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one?
The canonical SMILES for 4-hydroxy-1,3-dimethyl-5-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one is Cc1nn(C)c2[nH]c(=O)c(-c3ccccc3)c(O)c12.
What is the InChIKey of 4-hydroxy-1,3-dimethyl-5-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one?
The InChIKey is FNLKKUVKOQVAIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O2/c1-8-10-12(18)11(9-6-4-3-5-7-9)14(19)15-13(10)17(2)16-8/h3-7H,1-2H3,(H2,15,18,19).
What are the key properties of 4-hydroxy-1,3-dimethyl-5-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one?
4-hydroxy-1,3-dimethyl-5-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one has a molecular weight of 255.28 g/mol, XLogP of 1.94, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-1,3-dimethyl-5-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one is sourced from PubChem (CID 135520434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).