C21H24Cl2N2O2S — CID 135520576
N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]acetamide (PubChem CID 135520576) has the molecular formula C21H24Cl2N2O2S and a molecular weight of 439.41 g/mol. Its IUPAC name is N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]acetamide.
| Compound Name | N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 135520576 |
| Molecular Formula | C21H24Cl2N2O2S |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]acetamide |
| SMILES | Cc1c(C)c(C)c(CSCC(=O)N/N=C/c2cc(Cl)cc(Cl)c2O)c(C)c1C |
| InChI | InChI=1S/C21H24Cl2N2O2S/c1-11-12(2)14(4)18(15(5)13(11)3)9-28-10-20(26)25-24-8-16-6-17(22)7-19(23)21(16)27/h6-8,27H,9-10H2,1-5H3,(H,25,26)/b24-8+ |
| InChIKey | WGWFMRJJUAFTOW-KTZMUZOWSA-N |
| XLogP | 5.62 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|