C12H17N3O2S — CID 135520591
1-[(E)-(4-hydroxyphenyl)methylideneamino]-3-(3-methoxypropyl)thiourea (PubChem CID 135520591) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is 1-[(E)-(4-hydroxyphenyl)methylideneamino]-3-(3-methoxypropyl)thiourea.
| Compound Name | 1-[(E)-(4-hydroxyphenyl)methylideneamino]-3-(3-methoxypropyl)thiourea |
|---|---|
| PubChem CID | 135520591 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 1-[(E)-(4-hydroxyphenyl)methylideneamino]-3-(3-methoxypropyl)thiourea |
| SMILES | COCCCNC(=S)N/N=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C12H17N3O2S/c1-17-8-2-7-13-12(18)15-14-9-10-3-5-11(16)6-4-10/h3-6,9,16H,2,7-8H2,1H3,(H2,13,15,18)/b14-9+ |
| InChIKey | FXOVBPVLTRSFIK-NTEUORMPSA-N |
| XLogP | 1.23 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|