About (3E)-5-bromo-3-[(E)-(3,4-dichlorophenyl)methylidenehydrazinylidene]-1H-indol-2-one
(3E)-5-bromo-3-[(E)-(3,4-dichlorophenyl)methylidenehydrazinylidene]-1H-indol-2-one (PubChem CID 135520669) has the molecular formula C15H8BrCl2N3O
and a molecular weight of 397.06 g/mol. Its IUPAC name is (3E)-5-bromo-3-[(E)-(3,4-dichlorophenyl)methylidenehydrazinylidene]-1H-indol-2-one.
Molecular Properties
| Compound Name | (3E)-5-bromo-3-[(E)-(3,4-dichlorophenyl)methylidenehydrazinylidene]-1H-indol-2-one |
| PubChem CID | 135520669 |
| Molecular Formula | C15H8BrCl2N3O |
| Molecular Weight | 397.06 g/mol |
| Exact Mass | 394.92 |
| IUPAC Name | (3E)-5-bromo-3-[(E)-(3,4-dichlorophenyl)methylidenehydrazinylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(Br)cc2/C1=N\N=C\c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H8BrCl2N3O/c16-9-2-4-13-10(6-9)14(15(22)20-13)21-19-7-8-1-3-11(17)12(18)5-8/h1-7H,(H,20,21,22)/b19-7+ |
| InChIKey | KMJMJPNFFXKNMG-FBCYGCLPSA-N |
| XLogP | 4.53 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.06 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3E)-5-bromo-3-[(E)-(3,4-dichlorophenyl)methylidenehydrazinylidene]-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-5-bromo-3-[(E)-(3,4-dichlorophenyl)methylidenehydrazinylidene]-1H-indol-2-one?
The IUPAC name of (3E)-5-bromo-3-[(E)-(3,4-dichlorophenyl)methylidenehydrazinylidene]-1H-indol-2-one (CID 135520669) is (3E)-5-bromo-3-[(E)-(3,4-dichlorophenyl)methylidenehydrazinylidene]-1H-indol-2-one.
What is the SMILES notation for (3E)-5-bromo-3-[(E)-(3,4-dichlorophenyl)methylidenehydrazinylidene]-1H-indol-2-one?
The canonical SMILES for (3E)-5-bromo-3-[(E)-(3,4-dichlorophenyl)methylidenehydrazinylidene]-1H-indol-2-one is O=C1Nc2ccc(Br)cc2/C1=N\N=C\c1ccc(Cl)c(Cl)c1.
What is the InChIKey of (3E)-5-bromo-3-[(E)-(3,4-dichlorophenyl)methylidenehydrazinylidene]-1H-indol-2-one?
The InChIKey is KMJMJPNFFXKNMG-FBCYGCLPSA-N. The full InChI is InChI=1S/C15H8BrCl2N3O/c16-9-2-4-13-10(6-9)14(15(22)20-13)21-19-7-8-1-3-11(17)12(18)5-8/h1-7H,(H,20,21,22)/b19-7+.
What are the key properties of (3E)-5-bromo-3-[(E)-(3,4-dichlorophenyl)methylidenehydrazinylidene]-1H-indol-2-one?
(3E)-5-bromo-3-[(E)-(3,4-dichlorophenyl)methylidenehydrazinylidene]-1H-indol-2-one has a molecular weight of 397.06 g/mol, XLogP of 4.53, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-5-bromo-3-[(E)-(3,4-dichlorophenyl)methylidenehydrazinylidene]-1H-indol-2-one is sourced from PubChem (CID 135520669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).