C19H16N4O5 — CID 135521453
3-(1,3-benzodioxol-5-yl)-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-1H-pyrazole-5-carboxamide (PubChem CID 135521453) has the molecular formula C19H16N4O5 and a molecular weight of 380.36 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 135521453 |
| Molecular Formula | C19H16N4O5 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-1H-pyrazole-5-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)c2cc(-c3ccc4c(c3)OCO4)n[nH]2)ccc1O |
| InChI | InChI=1S/C19H16N4O5/c1-26-17-6-11(2-4-15(17)24)9-20-23-19(25)14-8-13(21-22-14)12-3-5-16-18(7-12)28-10-27-16/h2-9,24H,10H2,1H3,(H,21,22)(H,23,25)/b20-9+ |
| InChIKey | FYLFTMDKLBRQMA-AWQFTUOYSA-N |
| XLogP | 2.28 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|