C18H17N5OS2 — CID 135521511
N-[(E)-[4-(3,5-dimethylpyridin-1-ium-1-yl)-2-oxo-3H-1,3-thiazol-5-yl]methylideneamino]-N'-phenylcarbamimidothioate (PubChem CID 135521511) has the molecular formula C18H17N5OS2 and a molecular weight of 383.50 g/mol. Its IUPAC name is N-[(E)-[4-(3,5-dimethylpyridin-1-ium-1-yl)-2-oxo-3H-1,3-thiazol-5-yl]methylideneamino]-N'-phenylcarbamimidothioate.
| Compound Name | N-[(E)-[4-(3,5-dimethylpyridin-1-ium-1-yl)-2-oxo-3H-1,3-thiazol-5-yl]methylideneamino]-N'-phenylcarbamimidothioate |
|---|---|
| PubChem CID | 135521511 |
| Molecular Formula | C18H17N5OS2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | N-[(E)-[4-(3,5-dimethylpyridin-1-ium-1-yl)-2-oxo-3H-1,3-thiazol-5-yl]methylideneamino]-N'-phenylcarbamimidothioate |
| SMILES | Cc1cc(C)c[n+](-c2[nH]c(=O)sc2/C=N/N/C([S-])=N/c2ccccc2)c1 |
| InChI | InChI=1S/C18H17N5OS2/c1-12-8-13(2)11-23(10-12)16-15(26-18(24)21-16)9-19-22-17(25)20-14-6-4-3-5-7-14/h3-11H,1-2H3,(H2-,19,20,21,22,24,25) |
| InChIKey | CDYLYEWVJPCVFY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_C(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|