C20H20N4O4 — CID 135521530
1-(3,4-dimethylphenyl)-6-hydroxy-5-[(E)-[(4-methoxyphenyl)hydrazinylidene]methyl]pyrimidine-2,4-dione (PubChem CID 135521530) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-6-hydroxy-5-[(E)-[(4-methoxyphenyl)hydrazinylidene]methyl]pyrimidine-2,4-dione.
| Compound Name | 1-(3,4-dimethylphenyl)-6-hydroxy-5-[(E)-[(4-methoxyphenyl)hydrazinylidene]methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135521530 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-6-hydroxy-5-[(E)-[(4-methoxyphenyl)hydrazinylidene]methyl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(N/N=C/c2c(O)n(-c3ccc(C)c(C)c3)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C20H20N4O4/c1-12-4-7-15(10-13(12)2)24-19(26)17(18(25)22-20(24)27)11-21-23-14-5-8-16(28-3)9-6-14/h4-11,23,26H,1-3H3,(H,22,25,27)/b21-11+ |
| InChIKey | WACXDGYACVJVRW-SRZZPIQSSA-N |
| XLogP | 2.30 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|