C21H22N2 — CID 135521804
6-methyl-N-(1-phenylethyl)-2,3,4,9-tetrahydrocarbazol-1-imine (PubChem CID 135521804) has the molecular formula C21H22N2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 6-methyl-N-(1-phenylethyl)-2,3,4,9-tetrahydrocarbazol-1-imine.
| Compound Name | 6-methyl-N-(1-phenylethyl)-2,3,4,9-tetrahydrocarbazol-1-imine |
|---|---|
| PubChem CID | 135521804 |
| Molecular Formula | C21H22N2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 6-methyl-N-(1-phenylethyl)-2,3,4,9-tetrahydrocarbazol-1-imine |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CCC/C3=N\C(C)c1ccccc1 |
| InChI | InChI=1S/C21H22N2/c1-14-11-12-19-18(13-14)17-9-6-10-20(21(17)23-19)22-15(2)16-7-4-3-5-8-16/h3-5,7-8,11-13,15,23H,6,9-10H2,1-2H3/b22-20+ |
| InChIKey | RJSFOOKMRMBWIY-LSDHQDQOSA-N |
| XLogP | 5.36 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|