C25H25F6N5O4 — CID 135522395
(5S,6S)-6-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-5-(4-methoxyphenyl)-1-methyl-4-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]piperazin-2-one (PubChem CID 135522395) has the molecular formula C25H25F6N5O4 and a molecular weight of 573.49 g/mol. Its IUPAC name is (5S,6S)-6-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-5-(4-methoxyphenyl)-1-methyl-4-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]piperazin-2-one.
| Compound Name | (5S,6S)-6-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-5-(4-methoxyphenyl)-1-methyl-4-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 135522395 |
| Molecular Formula | C25H25F6N5O4 |
| Molecular Weight | 573.49 g/mol |
| Exact Mass | 573.18 |
| IUPAC Name | (5S,6S)-6-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-5-(4-methoxyphenyl)-1-methyl-4-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]piperazin-2-one |
| SMILES | COc1ccc([C@H]2[C@@H](COCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)N(C)C(=O)CN2Cc2n[nH]c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C25H25F6N5O4/c1-35-19(13-40-12-14-7-16(24(26,27)28)9-17(8-14)25(29,30)31)22(15-3-5-18(39-2)6-4-15)36(11-21(35)37)10-20-32-23(38)34-33-20/h3-9,19,22H,10-13H2,1-2H3,(H2,32,33,34,38)/t19-,22+/m1/s1 |
| InChIKey | HXRSXPXCRZFNNG-KNQAVFIVSA-N |
| XLogP | 3.74 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |