C27H29F6N5O3 — CID 135522396
(5S,6S)-6-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-1-ethyl-5-(4-ethylphenyl)-4-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]piperazin-2-one (PubChem CID 135522396) has the molecular formula C27H29F6N5O3 and a molecular weight of 585.55 g/mol. Its IUPAC name is (5S,6S)-6-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-1-ethyl-5-(4-ethylphenyl)-4-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]piperazin-2-one.
| Compound Name | (5S,6S)-6-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-1-ethyl-5-(4-ethylphenyl)-4-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 135522396 |
| Molecular Formula | C27H29F6N5O3 |
| Molecular Weight | 585.55 g/mol |
| Exact Mass | 585.22 |
| IUPAC Name | (5S,6S)-6-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-1-ethyl-5-(4-ethylphenyl)-4-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]piperazin-2-one |
| SMILES | CCc1ccc([C@H]2[C@@H](COCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)N(CC)C(=O)CN2Cc2n[nH]c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C27H29F6N5O3/c1-3-16-5-7-18(8-6-16)24-21(38(4-2)23(39)13-37(24)12-22-34-25(40)36-35-22)15-41-14-17-9-19(26(28,29)30)11-20(10-17)27(31,32)33/h5-11,21,24H,3-4,12-15H2,1-2H3,(H2,34,35,36,40)/t21-,24+/m1/s1 |
| InChIKey | WVAIAWWMEZOSAD-QPPBQGQZSA-N |
| XLogP | 4.69 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |