C14H14ClN5O4 — CID 135522538
N-[4-[N-acetyl-N'-[(2-chlorophenyl)methoxy]carbamimidoyl]-1,2,5-oxadiazol-3-yl]acetamide (PubChem CID 135522538) has the molecular formula C14H14ClN5O4 and a molecular weight of 351.75 g/mol. Its IUPAC name is N-[4-[N-acetyl-N'-[(2-chlorophenyl)methoxy]carbamimidoyl]-1,2,5-oxadiazol-3-yl]acetamide.
| Compound Name | N-[4-[N-acetyl-N'-[(2-chlorophenyl)methoxy]carbamimidoyl]-1,2,5-oxadiazol-3-yl]acetamide |
|---|---|
| PubChem CID | 135522538 |
| Molecular Formula | C14H14ClN5O4 |
| Molecular Weight | 351.75 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | N-[4-[N-acetyl-N'-[(2-chlorophenyl)methoxy]carbamimidoyl]-1,2,5-oxadiazol-3-yl]acetamide |
| SMILES | CC(=O)NC(=NOCc1ccccc1Cl)c1nonc1NC(C)=O |
| InChI | InChI=1S/C14H14ClN5O4/c1-8(21)16-13(12-14(17-9(2)22)20-24-18-12)19-23-7-10-5-3-4-6-11(10)15/h3-6H,7H2,1-2H3,(H,16,19,21)(H,17,20,22) |
| InChIKey | GBEVKYPGEPYKPW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 118.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.75 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|