About 6,8-dimethyl-9H-pyrrolo[3,2-h]quinoline
6,8-dimethyl-9H-pyrrolo[3,2-h]quinoline (PubChem CID 135523687) has the molecular formula C13H12N2
and a molecular weight of 196.25 g/mol. Its IUPAC name is 6,8-dimethyl-9H-pyrrolo[3,2-h]quinoline.
Molecular Properties
| Compound Name | 6,8-dimethyl-9H-pyrrolo[3,2-h]quinoline |
| PubChem CID | 135523687 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 6,8-dimethyl-9H-pyrrolo[3,2-h]quinoline |
| SMILES | Cc1cc(C)c2ccc3ccnc3c2[nH]1 |
| InChI | InChI=1S/C13H12N2/c1-8-7-9(2)15-13-11(8)4-3-10-5-6-14-12(10)13/h3-7,15H,1-2H3 |
| InChIKey | MLMAPLRXMVGQDO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6,8-dimethyl-9H-pyrrolo[3,2-h]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dimethyl-9H-pyrrolo[3,2-h]quinoline?
The IUPAC name of 6,8-dimethyl-9H-pyrrolo[3,2-h]quinoline (CID 135523687) is 6,8-dimethyl-9H-pyrrolo[3,2-h]quinoline.
What is the SMILES notation for 6,8-dimethyl-9H-pyrrolo[3,2-h]quinoline?
The canonical SMILES for 6,8-dimethyl-9H-pyrrolo[3,2-h]quinoline is Cc1cc(C)c2ccc3ccnc3c2[nH]1.
What is the InChIKey of 6,8-dimethyl-9H-pyrrolo[3,2-h]quinoline?
The InChIKey is MLMAPLRXMVGQDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2/c1-8-7-9(2)15-13-11(8)4-3-10-5-6-14-12(10)13/h3-7,15H,1-2H3.
What are the key properties of 6,8-dimethyl-9H-pyrrolo[3,2-h]quinoline?
6,8-dimethyl-9H-pyrrolo[3,2-h]quinoline has a molecular weight of 196.25 g/mol, XLogP of 3.33, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dimethyl-9H-pyrrolo[3,2-h]quinoline is sourced from PubChem (CID 135523687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).