C13H13N3O3 — CID 135523696
7,8-dimethoxy-5,10-dihydro-3H-pyrimido[4,5-b]quinolin-4-one (PubChem CID 135523696) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is 7,8-dimethoxy-5,10-dihydro-3H-pyrimido[4,5-b]quinolin-4-one.
| Compound Name | 7,8-dimethoxy-5,10-dihydro-3H-pyrimido[4,5-b]quinolin-4-one |
|---|---|
| PubChem CID | 135523696 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 7,8-dimethoxy-5,10-dihydro-3H-pyrimido[4,5-b]quinolin-4-one |
| SMILES | COc1cc2c(cc1OC)Nc1nc[nH]c(=O)c1C2 |
| InChI | InChI=1S/C13H13N3O3/c1-18-10-4-7-3-8-12(14-6-15-13(8)17)16-9(7)5-11(10)19-2/h4-6H,3H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | NVPFAFOQUJRLJO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |