C22H19ClN4O — CID 135523938
N-benzyl-4-[4-(3-chlorophenyl)-1H-pyrazol-5-yl]-N-methyl-1H-pyrrole-2-carboxamide (PubChem CID 135523938) has the molecular formula C22H19ClN4O and a molecular weight of 390.87 g/mol. Its IUPAC name is N-benzyl-4-[4-(3-chlorophenyl)-1H-pyrazol-5-yl]-N-methyl-1H-pyrrole-2-carboxamide.
| Compound Name | N-benzyl-4-[4-(3-chlorophenyl)-1H-pyrazol-5-yl]-N-methyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 135523938 |
| Molecular Formula | C22H19ClN4O |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | N-benzyl-4-[4-(3-chlorophenyl)-1H-pyrazol-5-yl]-N-methyl-1H-pyrrole-2-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1cc(-c2[nH]ncc2-c2cccc(Cl)c2)c[nH]1 |
| InChI | InChI=1S/C22H19ClN4O/c1-27(14-15-6-3-2-4-7-15)22(28)20-11-17(12-24-20)21-19(13-25-26-21)16-8-5-9-18(23)10-16/h2-13,24H,14H2,1H3,(H,25,26) |
| InChIKey | HJHGABLTQYNEHT-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 64.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |