C8H9ClN2O — CID 135524389
4-(chloromethyl)-2-cyclopropyl-1H-pyrimidin-6-one (PubChem CID 135524389) has the molecular formula C8H9ClN2O and a molecular weight of 184.63 g/mol. Its IUPAC name is 4-(chloromethyl)-2-cyclopropyl-1H-pyrimidin-6-one.
| Compound Name | 4-(chloromethyl)-2-cyclopropyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135524389 |
| Molecular Formula | C8H9ClN2O |
| Molecular Weight | 184.63 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 4-(chloromethyl)-2-cyclopropyl-1H-pyrimidin-6-one |
| SMILES | O=c1cc(CCl)nc(C2CC2)[nH]1 |
| InChI | InChI=1S/C8H9ClN2O/c9-4-6-3-7(12)11-8(10-6)5-1-2-5/h3,5H,1-2,4H2,(H,10,11,12) |
| InChIKey | QAQUTJMSBGEFAX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.63 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|