About 2-methylsulfanyl-3H-pyrimido[5,4-c]cinnolin-4-one
2-methylsulfanyl-3H-pyrimido[5,4-c]cinnolin-4-one (PubChem CID 135524437) has the molecular formula C11H8N4OS
and a molecular weight of 244.28 g/mol. Its IUPAC name is 2-methylsulfanyl-3H-pyrimido[5,4-c]cinnolin-4-one.
Molecular Properties
| Compound Name | 2-methylsulfanyl-3H-pyrimido[5,4-c]cinnolin-4-one |
| PubChem CID | 135524437 |
| Molecular Formula | C11H8N4OS |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 2-methylsulfanyl-3H-pyrimido[5,4-c]cinnolin-4-one |
| SMILES | CSc1nc2c(nnc3ccccc32)c(=O)[nH]1 |
| InChI | InChI=1S/C11H8N4OS/c1-17-11-12-8-6-4-2-3-5-7(6)14-15-9(8)10(16)13-11/h2-5H,1H3,(H,12,13,16) |
| InChIKey | YRHQFJLQKWMYKJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-methylsulfanyl-3H-pyrimido[5,4-c]cinnolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanyl-3H-pyrimido[5,4-c]cinnolin-4-one?
The IUPAC name of 2-methylsulfanyl-3H-pyrimido[5,4-c]cinnolin-4-one (CID 135524437) is 2-methylsulfanyl-3H-pyrimido[5,4-c]cinnolin-4-one.
What is the SMILES notation for 2-methylsulfanyl-3H-pyrimido[5,4-c]cinnolin-4-one?
The canonical SMILES for 2-methylsulfanyl-3H-pyrimido[5,4-c]cinnolin-4-one is CSc1nc2c(nnc3ccccc32)c(=O)[nH]1.
What is the InChIKey of 2-methylsulfanyl-3H-pyrimido[5,4-c]cinnolin-4-one?
The InChIKey is YRHQFJLQKWMYKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4OS/c1-17-11-12-8-6-4-2-3-5-7(6)14-15-9(8)10(16)13-11/h2-5H,1H3,(H,12,13,16).
What are the key properties of 2-methylsulfanyl-3H-pyrimido[5,4-c]cinnolin-4-one?
2-methylsulfanyl-3H-pyrimido[5,4-c]cinnolin-4-one has a molecular weight of 244.28 g/mol, XLogP of 1.59, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanyl-3H-pyrimido[5,4-c]cinnolin-4-one is sourced from PubChem (CID 135524437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).