C11H8N4OS — CID 135524437
2-methylsulfanyl-3H-pyrimido[5,4-c]cinnolin-4-one (PubChem CID 135524437) has the molecular formula C11H8N4OS and a molecular weight of 244.28 g/mol. Its IUPAC name is 2-methylsulfanyl-3H-pyrimido[5,4-c]cinnolin-4-one.
| Compound Name | 2-methylsulfanyl-3H-pyrimido[5,4-c]cinnolin-4-one |
|---|---|
| PubChem CID | 135524437 |
| Molecular Formula | C11H8N4OS |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 2-methylsulfanyl-3H-pyrimido[5,4-c]cinnolin-4-one |
| SMILES | CSc1nc2c(nnc3ccccc32)c(=O)[nH]1 |
| InChI | InChI=1S/C11H8N4OS/c1-17-11-12-8-6-4-2-3-5-7(6)14-15-9(8)10(16)13-11/h2-5H,1H3,(H,12,13,16) |
| InChIKey | YRHQFJLQKWMYKJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|