C16H17ClN4 — CID 135524869
2-[(3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-ylidene)amino]-N-methylethanamine (PubChem CID 135524869) has the molecular formula C16H17ClN4 and a molecular weight of 300.79 g/mol. Its IUPAC name is 2-[(3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-ylidene)amino]-N-methylethanamine.
| Compound Name | 2-[(3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-ylidene)amino]-N-methylethanamine |
|---|---|
| PubChem CID | 135524869 |
| Molecular Formula | C16H17ClN4 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-[(3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-ylidene)amino]-N-methylethanamine |
| SMILES | CNCC/N=C1\Nc2cc(Cl)ccc2Nc2ccccc21 |
| InChI | InChI=1S/C16H17ClN4/c1-18-8-9-19-16-12-4-2-3-5-13(12)20-14-7-6-11(17)10-15(14)21-16/h2-7,10,18,20H,8-9H2,1H3,(H,19,21) |
| InChIKey | YJJYKPCAQDDSGZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|