About 1,8,10-triazatricyclo[7.3.0.03,7]dodeca-3(7),8-dien-2-one
1,8,10-triazatricyclo[7.3.0.03,7]dodeca-3(7),8-dien-2-one (PubChem CID 135525211) has the molecular formula C9H11N3O
and a molecular weight of 177.21 g/mol. Its IUPAC name is 1,8,10-triazatricyclo[7.3.0.03,7]dodeca-3(7),8-dien-2-one.
Analyze 1,8,10-triazatricyclo[7.3.0.03,7]dodeca-3(7),8-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8,10-triazatricyclo[7.3.0.03,7]dodeca-3(7),8-dien-2-one?
The IUPAC name of 1,8,10-triazatricyclo[7.3.0.03,7]dodeca-3(7),8-dien-2-one (CID 135525211) is 1,8,10-triazatricyclo[7.3.0.03,7]dodeca-3(7),8-dien-2-one.
What is the SMILES notation for 1,8,10-triazatricyclo[7.3.0.03,7]dodeca-3(7),8-dien-2-one?
The canonical SMILES for 1,8,10-triazatricyclo[7.3.0.03,7]dodeca-3(7),8-dien-2-one is O=c1c2c(nc3n1CCN3)CCC2.
What is the InChIKey of 1,8,10-triazatricyclo[7.3.0.03,7]dodeca-3(7),8-dien-2-one?
The InChIKey is CATDHKKGDNWSLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O/c13-8-6-2-1-3-7(6)11-9-10-4-5-12(8)9/h1-5H2,(H,10,11).
What are the key properties of 1,8,10-triazatricyclo[7.3.0.03,7]dodeca-3(7),8-dien-2-one?
1,8,10-triazatricyclo[7.3.0.03,7]dodeca-3(7),8-dien-2-one has a molecular weight of 177.21 g/mol, XLogP of 0.16, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8,10-triazatricyclo[7.3.0.03,7]dodeca-3(7),8-dien-2-one is sourced from PubChem (CID 135525211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).