C26H31FN4O3 — CID 135525432
6-[(2E)-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]hydrazinyl]-1-(4-fluorophenyl)-3-methylpyrimidine-2,4-dione (PubChem CID 135525432) has the molecular formula C26H31FN4O3 and a molecular weight of 466.56 g/mol. Its IUPAC name is 6-[(2E)-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]hydrazinyl]-1-(4-fluorophenyl)-3-methylpyrimidine-2,4-dione.
| Compound Name | 6-[(2E)-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]hydrazinyl]-1-(4-fluorophenyl)-3-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135525432 |
| Molecular Formula | C26H31FN4O3 |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 6-[(2E)-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]hydrazinyl]-1-(4-fluorophenyl)-3-methylpyrimidine-2,4-dione |
| SMILES | Cn1c(=O)cc(N/N=C/c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)n(-c2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C26H31FN4O3/c1-25(2,3)19-12-16(13-20(23(19)33)26(4,5)6)15-28-29-21-14-22(32)30(7)24(34)31(21)18-10-8-17(27)9-11-18/h8-15,29,33H,1-7H3/b28-15+ |
| InChIKey | YLLUJGPOOXAVCX-RWPZCVJISA-N |
| XLogP | 4.42 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|