C27H35NO2 — CID 135526134
3-heptylimino-2-(1-hydroxy-2-naphthalen-1-ylethylidene)-5,5-dimethylcyclohexan-1-one (PubChem CID 135526134) has the molecular formula C27H35NO2 and a molecular weight of 405.58 g/mol. Its IUPAC name is 3-heptylimino-2-(1-hydroxy-2-naphthalen-1-ylethylidene)-5,5-dimethylcyclohexan-1-one.
| Compound Name | 3-heptylimino-2-(1-hydroxy-2-naphthalen-1-ylethylidene)-5,5-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 135526134 |
| Molecular Formula | C27H35NO2 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | 3-heptylimino-2-(1-hydroxy-2-naphthalen-1-ylethylidene)-5,5-dimethylcyclohexan-1-one |
| SMILES | CCCCCCC/N=C1\CC(C)(C)CC(=O)C1=C(O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C27H35NO2/c1-4-5-6-7-10-16-28-23-18-27(2,3)19-25(30)26(23)24(29)17-21-14-11-13-20-12-8-9-15-22(20)21/h8-9,11-15,29H,4-7,10,16-19H2,1-3H3/b26-24?,28-23+ |
| InChIKey | FBFDBUCALHRTJV-PSPBWOQKSA-N |
| XLogP | 6.99 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|