C24H29NO2 — CID 135526149
3-tert-butylimino-2-(1-hydroxy-2-naphthalen-1-ylethylidene)-5,5-dimethylcyclohexan-1-one (PubChem CID 135526149) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is 3-tert-butylimino-2-(1-hydroxy-2-naphthalen-1-ylethylidene)-5,5-dimethylcyclohexan-1-one.
| Compound Name | 3-tert-butylimino-2-(1-hydroxy-2-naphthalen-1-ylethylidene)-5,5-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 135526149 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 3-tert-butylimino-2-(1-hydroxy-2-naphthalen-1-ylethylidene)-5,5-dimethylcyclohexan-1-one |
| SMILES | CC1(C)CC(=O)C(=C(O)Cc2cccc3ccccc23)/C(=N/C(C)(C)C)C1 |
| InChI | InChI=1S/C24H29NO2/c1-23(2,3)25-19-14-24(4,5)15-21(27)22(19)20(26)13-17-11-8-10-16-9-6-7-12-18(16)17/h6-12,26H,13-15H2,1-5H3/b22-20?,25-19+ |
| InChIKey | WQJFXCWLASFLKN-NWIIVXHCSA-N |
| XLogP | 5.82 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|