C28H29NO2 — CID 135526153
2-(1-hydroxy-2-naphthalen-1-ylethylidene)-5,5-dimethyl-3-(2-phenylethylimino)cyclohexan-1-one (PubChem CID 135526153) has the molecular formula C28H29NO2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 2-(1-hydroxy-2-naphthalen-1-ylethylidene)-5,5-dimethyl-3-(2-phenylethylimino)cyclohexan-1-one.
| Compound Name | 2-(1-hydroxy-2-naphthalen-1-ylethylidene)-5,5-dimethyl-3-(2-phenylethylimino)cyclohexan-1-one |
|---|---|
| PubChem CID | 135526153 |
| Molecular Formula | C28H29NO2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 2-(1-hydroxy-2-naphthalen-1-ylethylidene)-5,5-dimethyl-3-(2-phenylethylimino)cyclohexan-1-one |
| SMILES | CC1(C)CC(=O)C(=C(O)Cc2cccc3ccccc23)/C(=N/CCc2ccccc2)C1 |
| InChI | InChI=1S/C28H29NO2/c1-28(2)18-24(29-16-15-20-9-4-3-5-10-20)27(26(31)19-28)25(30)17-22-13-8-12-21-11-6-7-14-23(21)22/h3-14,30H,15-19H2,1-2H3/b27-25?,29-24+ |
| InChIKey | DJLCDPDBCULACH-XWECPYHOSA-N |
| XLogP | 6.27 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|