About methyl 4-(4,4-dimethyl-2-naphthalen-1-ylimino-6-oxocyclohexylidene)-4-hydroxybutanoate
methyl 4-(4,4-dimethyl-2-naphthalen-1-ylimino-6-oxocyclohexylidene)-4-hydroxybutanoate (PubChem CID 135526364) has the molecular formula C23H25NO4
and a molecular weight of 379.46 g/mol. Its IUPAC name is methyl 4-(4,4-dimethyl-2-naphthalen-1-ylimino-6-oxocyclohexylidene)-4-hydroxybutanoate.
Molecular Properties
| Compound Name | methyl 4-(4,4-dimethyl-2-naphthalen-1-ylimino-6-oxocyclohexylidene)-4-hydroxybutanoate |
| PubChem CID | 135526364 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | methyl 4-(4,4-dimethyl-2-naphthalen-1-ylimino-6-oxocyclohexylidene)-4-hydroxybutanoate |
| SMILES | COC(=O)CCC(O)=C1C(=O)CC(C)(C)C/C1=N\c1cccc2ccccc12 |
| InChI | InChI=1S/C23H25NO4/c1-23(2)13-18(22(20(26)14-23)19(25)11-12-21(27)28-3)24-17-10-6-8-15-7-4-5-9-16(15)17/h4-10,25H,11-14H2,1-3H3/b22-19?,24-18+ |
| InChIKey | PALOJJBFGJIFME-DBMXMVKASA-N |
| XLogP | 5.07 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(4,4-dimethyl-2-naphthalen-1-ylimino-6-oxocyclohexylidene)-4-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(4,4-dimethyl-2-naphthalen-1-ylimino-6-oxocyclohexylidene)-4-hydroxybutanoate?
The IUPAC name of methyl 4-(4,4-dimethyl-2-naphthalen-1-ylimino-6-oxocyclohexylidene)-4-hydroxybutanoate (CID 135526364) is methyl 4-(4,4-dimethyl-2-naphthalen-1-ylimino-6-oxocyclohexylidene)-4-hydroxybutanoate.
What is the SMILES notation for methyl 4-(4,4-dimethyl-2-naphthalen-1-ylimino-6-oxocyclohexylidene)-4-hydroxybutanoate?
The canonical SMILES for methyl 4-(4,4-dimethyl-2-naphthalen-1-ylimino-6-oxocyclohexylidene)-4-hydroxybutanoate is COC(=O)CCC(O)=C1C(=O)CC(C)(C)C/C1=N\c1cccc2ccccc12.
What is the InChIKey of methyl 4-(4,4-dimethyl-2-naphthalen-1-ylimino-6-oxocyclohexylidene)-4-hydroxybutanoate?
The InChIKey is PALOJJBFGJIFME-DBMXMVKASA-N. The full InChI is InChI=1S/C23H25NO4/c1-23(2)13-18(22(20(26)14-23)19(25)11-12-21(27)28-3)24-17-10-6-8-15-7-4-5-9-16(15)17/h4-10,25H,11-14H2,1-3H3/b22-19?,24-18+.
What are the key properties of methyl 4-(4,4-dimethyl-2-naphthalen-1-ylimino-6-oxocyclohexylidene)-4-hydroxybutanoate?
methyl 4-(4,4-dimethyl-2-naphthalen-1-ylimino-6-oxocyclohexylidene)-4-hydroxybutanoate has a molecular weight of 379.46 g/mol, XLogP of 5.07, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(4,4-dimethyl-2-naphthalen-1-ylimino-6-oxocyclohexylidene)-4-hydroxybutanoate is sourced from PubChem (CID 135526364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).