C17H19NO4 — CID 135526421
methyl 4-hydroxy-4-(2-oxo-6-phenyliminocyclohexylidene)butanoate (PubChem CID 135526421) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is methyl 4-hydroxy-4-(2-oxo-6-phenyliminocyclohexylidene)butanoate.
| Compound Name | methyl 4-hydroxy-4-(2-oxo-6-phenyliminocyclohexylidene)butanoate |
|---|---|
| PubChem CID | 135526421 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | methyl 4-hydroxy-4-(2-oxo-6-phenyliminocyclohexylidene)butanoate |
| SMILES | COC(=O)CCC(O)=C1C(=O)CCC/C1=N\c1ccccc1 |
| InChI | InChI=1S/C17H19NO4/c1-22-16(21)11-10-15(20)17-13(8-5-9-14(17)19)18-12-6-3-2-4-7-12/h2-4,6-7,20H,5,8-11H2,1H3/b17-15?,18-13+ |
| InChIKey | HZLQZRVDDKVTDI-KGJABYSTSA-N |
| XLogP | 3.28 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|