C15H14Cl2N6O — CID 135526513
2,4-dichloro-6-[(E)-[3-(3,5-dimethylpyrazol-1-yl)-5-methyl-1,2,4-triazol-4-yl]iminomethyl]phenol (PubChem CID 135526513) has the molecular formula C15H14Cl2N6O and a molecular weight of 365.22 g/mol. Its IUPAC name is 2,4-dichloro-6-[(E)-[3-(3,5-dimethylpyrazol-1-yl)-5-methyl-1,2,4-triazol-4-yl]iminomethyl]phenol.
| Compound Name | 2,4-dichloro-6-[(E)-[3-(3,5-dimethylpyrazol-1-yl)-5-methyl-1,2,4-triazol-4-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135526513 |
| Molecular Formula | C15H14Cl2N6O |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 2,4-dichloro-6-[(E)-[3-(3,5-dimethylpyrazol-1-yl)-5-methyl-1,2,4-triazol-4-yl]iminomethyl]phenol |
| SMILES | Cc1cc(C)n(-c2nnc(C)n2/N=C/c2cc(Cl)cc(Cl)c2O)n1 |
| InChI | InChI=1S/C15H14Cl2N6O/c1-8-4-9(2)22(21-8)15-20-19-10(3)23(15)18-7-11-5-12(16)6-13(17)14(11)24/h4-7,24H,1-3H3/b18-7+ |
| InChIKey | CLIKVXLRRMBSTQ-CNHKJKLMSA-N |
| XLogP | 3.28 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|