C13H9NO3 — CID 135526958
3-(4-hydroxyphenyl)-1,2-benzoxazol-6-ol (PubChem CID 135526958) has the molecular formula C13H9NO3 and a molecular weight of 227.22 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-1,2-benzoxazol-6-ol.
| Compound Name | 3-(4-hydroxyphenyl)-1,2-benzoxazol-6-ol |
|---|---|
| PubChem CID | 135526958 |
| Molecular Formula | C13H9NO3 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 3-(4-hydroxyphenyl)-1,2-benzoxazol-6-ol |
| SMILES | Oc1ccc(-c2noc3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C13H9NO3/c15-9-3-1-8(2-4-9)13-11-6-5-10(16)7-12(11)17-14-13/h1-7,15-16H |
| InChIKey | DPKXDXRRZZTHNM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |