About 3-(4-hydroxyphenyl)-2-methyl-2H-1,4-benzoxazine-5,7-diol
3-(4-hydroxyphenyl)-2-methyl-2H-1,4-benzoxazine-5,7-diol (PubChem CID 135527005) has the molecular formula C15H13NO4
and a molecular weight of 271.27 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-2-methyl-2H-1,4-benzoxazine-5,7-diol.
Molecular Properties
| Compound Name | 3-(4-hydroxyphenyl)-2-methyl-2H-1,4-benzoxazine-5,7-diol |
| PubChem CID | 135527005 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 3-(4-hydroxyphenyl)-2-methyl-2H-1,4-benzoxazine-5,7-diol |
| SMILES | CC1Oc2cc(O)cc(O)c2N=C1c1ccc(O)cc1 |
| InChI | InChI=1S/C15H13NO4/c1-8-14(9-2-4-10(17)5-3-9)16-15-12(19)6-11(18)7-13(15)20-8/h2-8,17-19H,1H3 |
| InChIKey | LIEZHLXUCGSNOU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(4-hydroxyphenyl)-2-methyl-2H-1,4-benzoxazine-5,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-hydroxyphenyl)-2-methyl-2H-1,4-benzoxazine-5,7-diol?
The IUPAC name of 3-(4-hydroxyphenyl)-2-methyl-2H-1,4-benzoxazine-5,7-diol (CID 135527005) is 3-(4-hydroxyphenyl)-2-methyl-2H-1,4-benzoxazine-5,7-diol.
What is the SMILES notation for 3-(4-hydroxyphenyl)-2-methyl-2H-1,4-benzoxazine-5,7-diol?
The canonical SMILES for 3-(4-hydroxyphenyl)-2-methyl-2H-1,4-benzoxazine-5,7-diol is CC1Oc2cc(O)cc(O)c2N=C1c1ccc(O)cc1.
What is the InChIKey of 3-(4-hydroxyphenyl)-2-methyl-2H-1,4-benzoxazine-5,7-diol?
The InChIKey is LIEZHLXUCGSNOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO4/c1-8-14(9-2-4-10(17)5-3-9)16-15-12(19)6-11(18)7-13(15)20-8/h2-8,17-19H,1H3.
What are the key properties of 3-(4-hydroxyphenyl)-2-methyl-2H-1,4-benzoxazine-5,7-diol?
3-(4-hydroxyphenyl)-2-methyl-2H-1,4-benzoxazine-5,7-diol has a molecular weight of 271.27 g/mol, XLogP of 2.71, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-hydroxyphenyl)-2-methyl-2H-1,4-benzoxazine-5,7-diol is sourced from PubChem (CID 135527005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).