C14H20N6O — CID 135527031
1-[(E)-(5-oxo-1,4-dihydropyrrolo[3,2-b]pyridin-3-yl)methylideneamino]-2-pentylguanidine (PubChem CID 135527031) has the molecular formula C14H20N6O and a molecular weight of 288.36 g/mol. Its IUPAC name is 1-[(E)-(5-oxo-1,4-dihydropyrrolo[3,2-b]pyridin-3-yl)methylideneamino]-2-pentylguanidine.
| Compound Name | 1-[(E)-(5-oxo-1,4-dihydropyrrolo[3,2-b]pyridin-3-yl)methylideneamino]-2-pentylguanidine |
|---|---|
| PubChem CID | 135527031 |
| Molecular Formula | C14H20N6O |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 1-[(E)-(5-oxo-1,4-dihydropyrrolo[3,2-b]pyridin-3-yl)methylideneamino]-2-pentylguanidine |
| SMILES | CCCCC/N=C(\N)N/N=C/c1c[nH]c2ccc(=O)[nH]c12 |
| InChI | InChI=1S/C14H20N6O/c1-2-3-4-7-16-14(15)20-18-9-10-8-17-11-5-6-12(21)19-13(10)11/h5-6,8-9,17H,2-4,7H2,1H3,(H,19,21)(H3,15,16,20)/b18-9+ |
| InChIKey | GFTNLJUJJXRKKK-GIJQJNRQSA-N |
| XLogP | 1.28 |
| TPSA | 111.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|