C25H22Cl2F3N5O2 — CID 135527871
N-[(4-chlorophenyl)methoxyiminomethyl]-4-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]benzamide (PubChem CID 135527871) has the molecular formula C25H22Cl2F3N5O2 and a molecular weight of 552.38 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methoxyiminomethyl]-4-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]benzamide.
| Compound Name | N-[(4-chlorophenyl)methoxyiminomethyl]-4-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 135527871 |
| Molecular Formula | C25H22Cl2F3N5O2 |
| Molecular Weight | 552.38 g/mol |
| Exact Mass | 551.11 |
| IUPAC Name | N-[(4-chlorophenyl)methoxyiminomethyl]-4-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]benzamide |
| SMILES | O=C(NC=NOCc1ccc(Cl)cc1)c1ccc(N2CCN(c3ncc(C(F)(F)F)cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C25H22Cl2F3N5O2/c26-20-5-1-17(2-6-20)15-37-33-16-32-24(36)18-3-7-21(8-4-18)34-9-11-35(12-10-34)23-22(27)13-19(14-31-23)25(28,29)30/h1-8,13-14,16H,9-12,15H2,(H,32,33,36) |
| InChIKey | QUHHEZXSHGKSGP-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.38 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|